About N,N-Diethylethanamine--trichlorogermane (1/1)
N,N-Diethylethanamine--trichlorogermane (1/1) (PubChem CID 73182129) has the molecular formula C6H15Cl3GeN
and a molecular weight of 280.16 g/mol.
Molecular Properties
| Compound Name | N,N-Diethylethanamine--trichlorogermane (1/1) |
| PubChem CID | 73182129 |
| Molecular Formula | C6H15Cl3GeN |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | — |
| SMILES | CCN(CC)CC.Cl[Ge](Cl)Cl |
| InChI | InChI=1S/C6H15N.Cl3Ge/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3; |
| InChIKey | BPJHGIIIESYTNK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-Diethylethanamine--trichlorogermane (1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-Diethylethanamine--trichlorogermane (1/1)?
The IUPAC name of N,N-Diethylethanamine--trichlorogermane (1/1) (CID 73182129) is not available.
What is the SMILES notation for N,N-Diethylethanamine--trichlorogermane (1/1)?
The canonical SMILES for N,N-Diethylethanamine--trichlorogermane (1/1) is CCN(CC)CC.Cl[Ge](Cl)Cl.
What is the InChIKey of N,N-Diethylethanamine--trichlorogermane (1/1)?
The InChIKey is BPJHGIIIESYTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.Cl3Ge/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3;.
What are the key properties of N,N-Diethylethanamine--trichlorogermane (1/1)?
N,N-Diethylethanamine--trichlorogermane (1/1) has a molecular weight of 280.16 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-Diethylethanamine--trichlorogermane (1/1) is sourced from PubChem (CID 73182129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).