C26H20ClF3N2O6 — CID 22354915
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[3-(methoxymethyl)phenyl]-2-(2-nitrophenoxy)-3-oxopentanenitrile (PubChem CID 22354915) has the molecular formula C26H20ClF3N2O6 and a molecular weight of 548.90 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[3-(methoxymethyl)phenyl]-2-(2-nitrophenoxy)-3-oxopentanenitrile.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[3-(methoxymethyl)phenyl]-2-(2-nitrophenoxy)-3-oxopentanenitrile |
|---|---|
| PubChem CID | 22354915 |
| Molecular Formula | C26H20ClF3N2O6 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[3-(methoxymethyl)phenyl]-2-(2-nitrophenoxy)-3-oxopentanenitrile |
| SMILES | COCc1cccc(C(C#N)(Oc2ccccc2[N+](=O)[O-])C(=O)CCOc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C26H20ClF3N2O6/c1-36-15-17-5-4-6-18(13-17)25(16-31,38-23-8-3-2-7-21(23)32(34)35)24(33)11-12-37-22-10-9-19(14-20(22)27)26(28,29)30/h2-10,13-14H,11-12,15H2,1H3 |
| InChIKey | LGBBVTLKQOXCCW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|