C16H12ClF3N2O4 — CID 57091219
5-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-nitrobenzamide (PubChem CID 57091219) has the molecular formula C16H12ClF3N2O4 and a molecular weight of 388.73 g/mol. Its IUPAC name is 5-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-nitrobenzamide.
| Compound Name | 5-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 57091219 |
| Molecular Formula | C16H12ClF3N2O4 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 5-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-nitrobenzamide |
| SMILES | NC(=O)c1cc(CCOc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClF3N2O4/c17-12-8-10(16(18,19)20)2-4-14(12)26-6-5-9-1-3-13(22(24)25)11(7-9)15(21)23/h1-4,7-8H,5-6H2,(H2,21,23) |
| InChIKey | HCBGLACLSUSKIB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|