C22H10Cl2O6-2 — CID 22402593
2,4-bis(4-carbonochloridoylphenyl)benzene-1,3-dicarboxylate (PubChem CID 22402593) has the molecular formula C22H10Cl2O6-2 and a molecular weight of 441.22 g/mol. Its IUPAC name is 2,4-bis(4-carbonochloridoylphenyl)benzene-1,3-dicarboxylate.
| Compound Name | 2,4-bis(4-carbonochloridoylphenyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22402593 |
| Molecular Formula | C22H10Cl2O6-2 |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | 2,4-bis(4-carbonochloridoylphenyl)benzene-1,3-dicarboxylate |
| SMILES | O=C(Cl)c1ccc(-c2ccc(C(=O)[O-])c(-c3ccc(C(=O)Cl)cc3)c2C(=O)[O-])cc1 |
| InChI | InChI=1S/C22H12Cl2O6/c23-19(25)13-5-1-11(2-6-13)15-9-10-16(21(27)28)17(18(15)22(29)30)12-3-7-14(8-4-12)20(24)26/h1-10H,(H,27,28)(H,29,30)/p-2 |
| InChIKey | KRUQMZDKIQKFJN-UHFFFAOYSA-L |
| XLogP | 2.51 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|