C30H30N4O4 — CID 22405177
2-[6-[1-(4-aminobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]hexyl]isoindole-1,3-dione (PubChem CID 22405177) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-[6-[1-(4-aminobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[1-(4-aminobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22405177 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[6-[1-(4-aminobenzoyl)-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]hexyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(C(=O)N2CCC(=O)N(CCCCCCN3C(=O)c4ccccc4C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N4O4/c31-22-15-13-21(14-16-22)28(36)33-20-17-27(35)32(25-11-5-6-12-26(25)33)18-7-1-2-8-19-34-29(37)23-9-3-4-10-24(23)30(34)38/h3-6,9-16H,1-2,7-8,17-20,31H2 |
| InChIKey | DRHZZIBRVGMZIH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|