C26H33FN4O3 — CID 22480489
1-[2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]-3-(4-nitrophenyl)urea (PubChem CID 22480489) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is 1-[2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 22480489 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-[2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)NC1CCCCC1CN1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H33FN4O3/c27-22-7-5-19(6-8-22)17-20-13-15-30(16-14-20)18-21-3-1-2-4-25(21)29-26(32)28-23-9-11-24(12-10-23)31(33)34/h5-12,20-21,25H,1-4,13-18H2,(H2,28,29,32) |
| InChIKey | VLHOWQOFOBQBCW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|