C23H27N3O6S — CID 22485328
1-cyclopropyl-4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide (PubChem CID 22485328) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22485328 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-cyclopropyl-4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(Nc3ccc4c(c3)OCCO4)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C23H27N3O6S/c27-22(25-28)23(9-11-26(12-10-23)18-4-5-18)33(29,30)19-6-1-16(2-7-19)24-17-3-8-20-21(15-17)32-14-13-31-20/h1-3,6-8,15,18,24,28H,4-5,9-14H2,(H,25,27) |
| InChIKey | LBGRZQSJJFCEKH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|