C17H26N3O3+ — CID 2260183
N'-[(E)-1-(4-methoxyphenyl)but-1-enyl]-2-morpholin-4-ium-4-ylacetohydrazide (PubChem CID 2260183) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is N'-[(E)-1-(4-methoxyphenyl)but-1-enyl]-2-morpholin-4-ium-4-ylacetohydrazide.
| Compound Name | N'-[(E)-1-(4-methoxyphenyl)but-1-enyl]-2-morpholin-4-ium-4-ylacetohydrazide |
|---|---|
| PubChem CID | 2260183 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N'-[(E)-1-(4-methoxyphenyl)but-1-enyl]-2-morpholin-4-ium-4-ylacetohydrazide |
| SMILES | CC/C=C(/NNC(=O)C[NH+]1CCOCC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-4-16(14-5-7-15(22-2)8-6-14)18-19-17(21)13-20-9-11-23-12-10-20/h4-8,18H,3,9-13H2,1-2H3,(H,19,21)/p+1/b16-4+ |
| InChIKey | GPDWSNNOAIAJFD-AYSLTRBKSA-O |
| XLogP | -0.02 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|