C11H12BrN — CID 22626860
7-bromo-4,4-dimethyl-3H-isoquinoline (PubChem CID 22626860) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is 7-bromo-4,4-dimethyl-3H-isoquinoline.
| Compound Name | 7-bromo-4,4-dimethyl-3H-isoquinoline |
|---|---|
| PubChem CID | 22626860 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 7-bromo-4,4-dimethyl-3H-isoquinoline |
| SMILES | CC1(C)CN=Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H12BrN/c1-11(2)7-13-6-8-5-9(12)3-4-10(8)11/h3-6H,7H2,1-2H3 |
| InChIKey | DNPLPYRHHOYMSC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |