C26H25N3 — CID 22675602
1-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethyl-3-(naphthalen-1-ylmethyl)guanidine (PubChem CID 22675602) has the molecular formula C26H25N3 and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethyl-3-(naphthalen-1-ylmethyl)guanidine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethyl-3-(naphthalen-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 22675602 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethyl-3-(naphthalen-1-ylmethyl)guanidine |
| SMILES | [H]/N=C(\N(C)Cc1cccc2ccccc12)N(C)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C26H25N3/c1-28(17-21-10-5-8-18-7-3-4-11-22(18)21)26(27)29(2)24-16-15-20-14-13-19-9-6-12-23(24)25(19)20/h3-12,15-16,27H,13-14,17H2,1-2H3/b27-26+ |
| InChIKey | STTJRAOXPAQMSJ-CYYJNZCTSA-N |
| XLogP | 5.59 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|