About 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol
3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol (PubChem CID 22707877) has the molecular formula C24H30N4O
and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol |
| PubChem CID | 22707877 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol |
| SMILES | CC1CN(CCC(O)c2ccccc2)CCC1(C)c1cccc(-c2cn[nH]n2)c1 |
| InChI | InChI=1S/C24H30N4O/c1-18-17-28(13-11-23(29)19-7-4-3-5-8-19)14-12-24(18,2)21-10-6-9-20(15-21)22-16-25-27-26-22/h3-10,15-16,18,23,29H,11-14,17H2,1-2H3,(H,25,26,27) |
| InChIKey | GNVLNOZEJZFQCZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol?
The IUPAC name of 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol (CID 22707877) is 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol.
What is the SMILES notation for 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol?
The canonical SMILES for 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol is CC1CN(CCC(O)c2ccccc2)CCC1(C)c1cccc(-c2cn[nH]n2)c1.
What is the InChIKey of 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol?
The InChIKey is GNVLNOZEJZFQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O/c1-18-17-28(13-11-23(29)19-7-4-3-5-8-19)14-12-24(18,2)21-10-6-9-20(15-21)22-16-25-27-26-22/h3-10,15-16,18,23,29H,11-14,17H2,1-2H3,(H,25,26,27).
What are the key properties of 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol?
3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol has a molecular weight of 390.53 g/mol, XLogP of 4.19, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-dimethyl-4-[3-(2H-triazol-4-yl)phenyl]piperidin-1-yl]-1-phenylpropan-1-ol is sourced from PubChem (CID 22707877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).