C24H28BrN3OS — CID 22735774
1-(2-amino-4-bromophenyl)-4-(6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl)butan-1-one (PubChem CID 22735774) has the molecular formula C24H28BrN3OS and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-(2-amino-4-bromophenyl)-4-(6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl)butan-1-one.
| Compound Name | 1-(2-amino-4-bromophenyl)-4-(6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl)butan-1-one |
|---|---|
| PubChem CID | 22735774 |
| Molecular Formula | C24H28BrN3OS |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 1-(2-amino-4-bromophenyl)-4-(6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl)butan-1-one |
| SMILES | Nc1cc(Br)ccc1C(=O)CCCN1CCC2C(C1)c1cccc3c1N2CCCS3 |
| InChI | InChI=1S/C24H28BrN3OS/c25-16-7-8-18(20(26)14-16)22(29)5-2-10-27-12-9-21-19(15-27)17-4-1-6-23-24(17)28(21)11-3-13-30-23/h1,4,6-8,14,19,21H,2-3,5,9-13,15,26H2 |
| InChIKey | SLARGICHHUPLQU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|