C10H8Cl2N2O2S — CID 22771650
1-(2,5-dichlorophenyl)sulfonyl-4-methylpyrazole (PubChem CID 22771650) has the molecular formula C10H8Cl2N2O2S and a molecular weight of 291.16 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-methylpyrazole.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-methylpyrazole |
|---|---|
| PubChem CID | 22771650 |
| Molecular Formula | C10H8Cl2N2O2S |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-methylpyrazole |
| SMILES | Cc1cnn(S(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2O2S/c1-7-5-13-14(6-7)17(15,16)10-4-8(11)2-3-9(10)12/h2-6H,1H3 |
| InChIKey | WCGMZFJRUCPYDH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |