C17H36N2OSi — CID 22822024
(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-methyl-2-pyrrolidin-1-ylcyclohexan-1-amine (PubChem CID 22822024) has the molecular formula C17H36N2OSi and a molecular weight of 312.57 g/mol. Its IUPAC name is (1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-methyl-2-pyrrolidin-1-ylcyclohexan-1-amine.
| Compound Name | (1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-methyl-2-pyrrolidin-1-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 22822024 |
| Molecular Formula | C17H36N2OSi |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-methyl-2-pyrrolidin-1-ylcyclohexan-1-amine |
| SMILES | CN[C@H]1CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C17H36N2OSi/c1-17(2,3)21(5,6)20-15-11-9-10-14(18-4)16(15)19-12-7-8-13-19/h14-16,18H,7-13H2,1-6H3/t14-,15-,16+/m0/s1 |
| InChIKey | XNDFHVJMNOQLRX-HRCADAONSA-N |
| XLogP | 3.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|