C18H35NOSi — CID 102181386
tert-butyl-dimethyl-[[(1R,2R,3S,5S)-2-pyrrolidin-1-yl-3-bicyclo[3.2.1]octanyl]oxy]silane (PubChem CID 102181386) has the molecular formula C18H35NOSi and a molecular weight of 309.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,3S,5S)-2-pyrrolidin-1-yl-3-bicyclo[3.2.1]octanyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,3S,5S)-2-pyrrolidin-1-yl-3-bicyclo[3.2.1]octanyl]oxy]silane |
|---|---|
| PubChem CID | 102181386 |
| Molecular Formula | C18H35NOSi |
| Molecular Weight | 309.57 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,3S,5S)-2-pyrrolidin-1-yl-3-bicyclo[3.2.1]octanyl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H]2CC[C@H](C2)[C@H]1N1CCCC1 |
| InChI | InChI=1S/C18H35NOSi/c1-18(2,3)21(4,5)20-16-13-14-8-9-15(12-14)17(16)19-10-6-7-11-19/h14-17H,6-13H2,1-5H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | OHVCGCMRJGKLNX-VVLHAWIVSA-N |
| XLogP | 4.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|