C20H22N2O3S — CID 22865073
(4aR,10bR)-10b-methyl-3-oxo-8-[4-(sulfinoamino)phenyl]-1,2,4,4a,5,6-hexahydrobenzo[f]quinoline (PubChem CID 22865073) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (4aR,10bR)-10b-methyl-3-oxo-8-[4-(sulfinoamino)phenyl]-1,2,4,4a,5,6-hexahydrobenzo[f]quinoline.
| Compound Name | (4aR,10bR)-10b-methyl-3-oxo-8-[4-(sulfinoamino)phenyl]-1,2,4,4a,5,6-hexahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 22865073 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (4aR,10bR)-10b-methyl-3-oxo-8-[4-(sulfinoamino)phenyl]-1,2,4,4a,5,6-hexahydrobenzo[f]quinoline |
| SMILES | C[C@]12CCC(=O)N[C@@H]1CCc1cc(-c3ccc(NS(=O)O)cc3)ccc12 |
| InChI | InChI=1S/C20H22N2O3S/c1-20-11-10-19(23)21-18(20)9-5-15-12-14(4-8-17(15)20)13-2-6-16(7-3-13)22-26(24)25/h2-4,6-8,12,18,22H,5,9-11H2,1H3,(H,21,23)(H,24,25)/t18-,20-/m1/s1 |
| InChIKey | HOEZYTBKVFLMAJ-UYAOXDASSA-N |
| XLogP | 3.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|