C38H38F3N5O6 — CID 22905009
3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905009) has the molecular formula C38H38F3N5O6 and a molecular weight of 717.75 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905009 |
| Molecular Formula | C38H38F3N5O6 |
| Molecular Weight | 717.75 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCCCc1ccc2c(c1)C(=O)N(C(CC(=O)O)c1ccccc1)C(c1ccccc1)C(=O)N2c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C36H37N5O4.C2HF3O2/c37-36(38)39-22-12-4-5-13-25-20-21-30-29(23-25)34(44)41(31(24-32(42)43)26-14-6-1-7-15-26)33(27-16-8-2-9-17-27)35(45)40(30)28-18-10-3-11-19-28;3-2(4,5)1(6)7/h1-3,6-11,14-21,23,31,33H,4-5,12-13,22,24H2,(H,42,43)(H4,37,38,39);(H,6,7) |
| InChIKey | PQZXTCLSBZHTHD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|