C26H34O4 — CID 22917830
6-cyclohexyl-4-hydroxy-2-[(4-phenylmethoxyphenyl)methyl]hexanoic acid (PubChem CID 22917830) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 6-cyclohexyl-4-hydroxy-2-[(4-phenylmethoxyphenyl)methyl]hexanoic acid.
| Compound Name | 6-cyclohexyl-4-hydroxy-2-[(4-phenylmethoxyphenyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 22917830 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 6-cyclohexyl-4-hydroxy-2-[(4-phenylmethoxyphenyl)methyl]hexanoic acid |
| SMILES | O=C(O)C(Cc1ccc(OCc2ccccc2)cc1)CC(O)CCC1CCCCC1 |
| InChI | InChI=1S/C26H34O4/c27-24(14-11-20-7-3-1-4-8-20)18-23(26(28)29)17-21-12-15-25(16-13-21)30-19-22-9-5-2-6-10-22/h2,5-6,9-10,12-13,15-16,20,23-24,27H,1,3-4,7-8,11,14,17-19H2,(H,28,29) |
| InChIKey | IENPZYRZRAMOAP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |