C24H28NO7PS — CID 22947744
6-[aminooxy-[4-[(2-oxo-1,3,2λ5-dioxaphosphepan-2-yl)methyl]phenyl]methyl]-8-methyl-5,6-dihydrothiepino[4,5-f][1,3]benzodioxol-9-one (PubChem CID 22947744) has the molecular formula C24H28NO7PS and a molecular weight of 505.53 g/mol. Its IUPAC name is 6-[aminooxy-[4-[(2-oxo-1,3,2λ5-dioxaphosphepan-2-yl)methyl]phenyl]methyl]-8-methyl-5,6-dihydrothiepino[4,5-f][1,3]benzodioxol-9-one.
| Compound Name | 6-[aminooxy-[4-[(2-oxo-1,3,2λ5-dioxaphosphepan-2-yl)methyl]phenyl]methyl]-8-methyl-5,6-dihydrothiepino[4,5-f][1,3]benzodioxol-9-one |
|---|---|
| PubChem CID | 22947744 |
| Molecular Formula | C24H28NO7PS |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 6-[aminooxy-[4-[(2-oxo-1,3,2λ5-dioxaphosphepan-2-yl)methyl]phenyl]methyl]-8-methyl-5,6-dihydrothiepino[4,5-f][1,3]benzodioxol-9-one |
| SMILES | CC1SC(C(ON)c2ccc(CP3(=O)OCCCCO3)cc2)Cc2cc3c(cc2C1=O)OCO3 |
| InChI | InChI=1S/C24H28NO7PS/c1-15-23(26)19-12-21-20(28-14-29-21)10-18(19)11-22(34-15)24(32-25)17-6-4-16(5-7-17)13-33(27)30-8-2-3-9-31-33/h4-7,10,12,15,22,24H,2-3,8-9,11,13-14,25H2,1H3 |
| InChIKey | RIGMDFHXXVDSLK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|