C15H12NOS+ — CID 22968814
5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene (PubChem CID 22968814) has the molecular formula C15H12NOS+ and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene.
| Compound Name | 5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
|---|---|
| PubChem CID | 22968814 |
| Molecular Formula | C15H12NOS+ |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
| SMILES | CSc1ccc2ccc3ccc[n+]4c3c2c1OC4 |
| InChI | InChI=1S/C15H12NOS/c1-18-12-7-6-10-4-5-11-3-2-8-16-9-17-15(12)13(10)14(11)16/h2-8H,9H2,1H3/q+1 |
| InChIKey | DVHYPTKYYAODRE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|