About 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene
5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene (PubChem CID 70283758) has the molecular formula C11H14OS2
and a molecular weight of 226.37 g/mol. Its IUPAC name is 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene |
| PubChem CID | 70283758 |
| Molecular Formula | C11H14OS2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene |
| SMILES | CSc1ccc(SC)c2c1CCCO2 |
| InChI | InChI=1S/C11H14OS2/c1-13-9-5-6-10(14-2)11-8(9)4-3-7-12-11/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | DMORLOQGNWXKKT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene?
The IUPAC name of 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene (CID 70283758) is 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene.
What is the SMILES notation for 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene?
The canonical SMILES for 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene is CSc1ccc(SC)c2c1CCCO2.
What is the InChIKey of 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene?
The InChIKey is DMORLOQGNWXKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS2/c1-13-9-5-6-10(14-2)11-8(9)4-3-7-12-11/h5-6H,3-4,7H2,1-2H3.
What are the key properties of 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene?
5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene has a molecular weight of 226.37 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-bis(methylsulfanyl)-3,4-dihydro-2H-chromene is sourced from PubChem (CID 70283758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).