C14H22NO3S+ — CID 2297714
2-(4-morpholin-4-ium-4-ylbutylsulfanyl)benzene-1,4-diol (PubChem CID 2297714) has the molecular formula C14H22NO3S+ and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(4-morpholin-4-ium-4-ylbutylsulfanyl)benzene-1,4-diol.
| Compound Name | 2-(4-morpholin-4-ium-4-ylbutylsulfanyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 2297714 |
| Molecular Formula | C14H22NO3S+ |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(4-morpholin-4-ium-4-ylbutylsulfanyl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(SCCCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C14H21NO3S/c16-12-3-4-13(17)14(11-12)19-10-2-1-5-15-6-8-18-9-7-15/h3-4,11,16-17H,1-2,5-10H2/p+1 |
| InChIKey | ZSTCOANFSRKXBU-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 54.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|