C17H16BrN — CID 23051179
5-bromo-1-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3(8),4,6,11,13,15-hexaene (PubChem CID 23051179) has the molecular formula C17H16BrN and a molecular weight of 314.23 g/mol. Its IUPAC name is 5-bromo-1-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3(8),4,6,11,13,15-hexaene.
| Compound Name | 5-bromo-1-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3(8),4,6,11,13,15-hexaene |
|---|---|
| PubChem CID | 23051179 |
| Molecular Formula | C17H16BrN |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 5-bromo-1-methyl-17-azatetracyclo[8.6.1.03,8.011,16]heptadeca-3(8),4,6,11,13,15-hexaene |
| SMILES | CC12Cc3cc(Br)ccc3CC(N1)c1ccccc12 |
| InChI | InChI=1S/C17H16BrN/c1-17-10-12-8-13(18)7-6-11(12)9-16(19-17)14-4-2-3-5-15(14)17/h2-8,16,19H,9-10H2,1H3 |
| InChIKey | LGCOGLSESLMEER-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |