About dibutyltin(2+);bis(3-methylbutan-1-olate)
dibutyltin(2+);bis(3-methylbutan-1-olate) (PubChem CID 23073809) has the molecular formula C18H40O2Sn
and a molecular weight of 407.23 g/mol. Its IUPAC name is dibutyltin(2+);bis(3-methylbutan-1-olate).
Molecular Properties
| Compound Name | dibutyltin(2+);bis(3-methylbutan-1-olate) |
| PubChem CID | 23073809 |
| Molecular Formula | C18H40O2Sn |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | dibutyltin(2+);bis(3-methylbutan-1-olate) |
| SMILES | CC(C)CC[O-].CC(C)CC[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C5H11O.2C4H9.Sn/c2*1-5(2)3-4-6;2*1-3-4-2;/h2*5H,3-4H2,1-2H3;2*1,3-4H2,2H3;/q2*-1;;;+2 |
| InChIKey | LDMRTXQOZLMIPR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);bis(3-methylbutan-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);bis(3-methylbutan-1-olate)?
The IUPAC name of dibutyltin(2+);bis(3-methylbutan-1-olate) (CID 23073809) is dibutyltin(2+);bis(3-methylbutan-1-olate).
What is the SMILES notation for dibutyltin(2+);bis(3-methylbutan-1-olate)?
The canonical SMILES for dibutyltin(2+);bis(3-methylbutan-1-olate) is CC(C)CC[O-].CC(C)CC[O-].CCCC[Sn+2]CCCC.
What is the InChIKey of dibutyltin(2+);bis(3-methylbutan-1-olate)?
The InChIKey is LDMRTXQOZLMIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11O.2C4H9.Sn/c2*1-5(2)3-4-6;2*1-3-4-2;/h2*5H,3-4H2,1-2H3;2*1,3-4H2,2H3;/q2*-1;;;+2.
What are the key properties of dibutyltin(2+);bis(3-methylbutan-1-olate)?
dibutyltin(2+);bis(3-methylbutan-1-olate) has a molecular weight of 407.23 g/mol, XLogP of 3.91, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);bis(3-methylbutan-1-olate) is sourced from PubChem (CID 23073809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).