C10H9F7N2 — CID 23104323
4-N-(2,2,3,3,4,4,4-heptafluorobutyl)benzene-1,4-diamine (PubChem CID 23104323) has the molecular formula C10H9F7N2 and a molecular weight of 290.18 g/mol. Its IUPAC name is 4-N-(2,2,3,3,4,4,4-heptafluorobutyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2,2,3,3,4,4,4-heptafluorobutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 23104323 |
| Molecular Formula | C10H9F7N2 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-N-(2,2,3,3,4,4,4-heptafluorobutyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F7N2/c11-8(12,9(13,14)10(15,16)17)5-19-7-3-1-6(18)2-4-7/h1-4,19H,5,18H2 |
| InChIKey | ZUSCDJGRYJGPIF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|