C27H32N2O7S — CID 23134358
ethyl 4-[4-[2-[[2-(2-amino-4-hydroxy-3-methylsulfonylphenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-3-methylbenzoate (PubChem CID 23134358) has the molecular formula C27H32N2O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is ethyl 4-[4-[2-[[2-(2-amino-4-hydroxy-3-methylsulfonylphenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-3-methylbenzoate.
| Compound Name | ethyl 4-[4-[2-[[2-(2-amino-4-hydroxy-3-methylsulfonylphenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 23134358 |
| Molecular Formula | C27H32N2O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | ethyl 4-[4-[2-[[2-(2-amino-4-hydroxy-3-methylsulfonylphenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCNCC(O)c3ccc(O)c(S(C)(=O)=O)c3N)cc2)c(C)c1 |
| InChI | InChI=1S/C27H32N2O7S/c1-4-35-27(32)19-7-10-21(17(2)15-19)18-5-8-20(9-6-18)36-14-13-29-16-24(31)22-11-12-23(30)26(25(22)28)37(3,33)34/h5-12,15,24,29-31H,4,13-14,16,28H2,1-3H3 |
| InChIKey | FTVBXZNSVUDWFV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|