C24H27NO7 — CID 23146947
5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 23146947) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 23146947 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCc1ocnc1C(=O)O |
| InChI | InChI=1S/C24H27NO7/c1-4-17-18(10-11-19-23(24(26)27)25-13-30-19)22(16-8-6-5-7-9-16)21(32-15-29-3)12-20(17)31-14-28-2/h5-9,12-13H,4,10-11,14-15H2,1-3H3,(H,26,27) |
| InChIKey | PNVVMDGXUINJEF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|