C24H29NO6 — CID 23147113
[5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazol-4-yl]methanol (PubChem CID 23147113) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 23147113 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [5-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethyl]-1,3-oxazol-4-yl]methanol |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCc1ocnc1CO |
| InChI | InChI=1S/C24H29NO6/c1-4-18-19(10-11-21-20(13-26)25-14-29-21)24(17-8-6-5-7-9-17)23(31-16-28-3)12-22(18)30-15-27-2/h5-9,12,14,26H,4,10-11,13,15-16H2,1-3H3 |
| InChIKey | IRMSGTHBOKCLJZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|