C18H21ClN3O3+ — CID 2321315
N-(2-chlorophenyl)-2-[4-(furan-2-carbonyl)-1-methylpiperazin-1-ium-1-yl]acetamide (PubChem CID 2321315) has the molecular formula C18H21ClN3O3+ and a molecular weight of 362.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(furan-2-carbonyl)-1-methylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(furan-2-carbonyl)-1-methylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2321315 |
| Molecular Formula | C18H21ClN3O3+ |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(furan-2-carbonyl)-1-methylpiperazin-1-ium-1-yl]acetamide |
| SMILES | C[N+]1(CC(=O)Nc2ccccc2Cl)CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-22(13-17(23)20-15-6-3-2-5-14(15)19)10-8-21(9-11-22)18(24)16-7-4-12-25-16/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | OALIWWSRDXXLKV-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|