About N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine
N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine (PubChem CID 23220269) has the molecular formula C20H36N4
and a molecular weight of 332.54 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine.
Molecular Properties
| Compound Name | N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine |
| PubChem CID | 23220269 |
| Molecular Formula | C20H36N4 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CCCCCCN=C=N |
| InChI | InChI=1S/C13H22N2.C7H14N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-2-3-4-5-6-9-7-8/h12-13H,1-10H2;8H,2-6H2,1H3 |
| InChIKey | BDDZWSQKGIIJCJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine?
The IUPAC name of N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine (CID 23220269) is N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine.
What is the SMILES notation for N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine?
The canonical SMILES for N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine is C(=NC1CCCCC1)=NC1CCCCC1.CCCCCCN=C=N.
What is the InChIKey of N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine?
The InChIKey is BDDZWSQKGIIJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.C7H14N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-2-3-4-5-6-9-7-8/h12-13H,1-10H2;8H,2-6H2,1H3.
What are the key properties of N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine?
N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine has a molecular weight of 332.54 g/mol, XLogP of 6.15, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine is sourced from PubChem (CID 23220269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).