C20H36N4 — CID 23220269
N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine (PubChem CID 23220269) has the molecular formula C20H36N4 and a molecular weight of 332.54 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine.
| Compound Name | N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine |
|---|---|
| PubChem CID | 23220269 |
| Molecular Formula | C20H36N4 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;N'-hexylmethanediimine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CCCCCCN=C=N |
| InChI | InChI=1S/C13H22N2.C7H14N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-2-3-4-5-6-9-7-8/h12-13H,1-10H2;8H,2-6H2,1H3 |
| InChIKey | BDDZWSQKGIIJCJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|