About [(2S,6R)-2-hydroxyundecan-6-yl] formate
[(2S,6R)-2-hydroxyundecan-6-yl] formate (PubChem CID 23230297) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is [(2S,6R)-2-hydroxyundecan-6-yl] formate.
Molecular Properties
| Compound Name | [(2S,6R)-2-hydroxyundecan-6-yl] formate |
| PubChem CID | 23230297 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | [(2S,6R)-2-hydroxyundecan-6-yl] formate |
| SMILES | CCCCC[C@H](CCC[C@H](C)O)OC=O |
| InChI | InChI=1S/C12H24O3/c1-3-4-5-8-12(15-10-13)9-6-7-11(2)14/h10-12,14H,3-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | OEZSMQMZRBNBMT-NWDGAFQWSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S,6R)-2-hydroxyundecan-6-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,6R)-2-hydroxyundecan-6-yl] formate?
The IUPAC name of [(2S,6R)-2-hydroxyundecan-6-yl] formate (CID 23230297) is [(2S,6R)-2-hydroxyundecan-6-yl] formate.
What is the SMILES notation for [(2S,6R)-2-hydroxyundecan-6-yl] formate?
The canonical SMILES for [(2S,6R)-2-hydroxyundecan-6-yl] formate is CCCCC[C@H](CCC[C@H](C)O)OC=O.
What is the InChIKey of [(2S,6R)-2-hydroxyundecan-6-yl] formate?
The InChIKey is OEZSMQMZRBNBMT-NWDGAFQWSA-N. The full InChI is InChI=1S/C12H24O3/c1-3-4-5-8-12(15-10-13)9-6-7-11(2)14/h10-12,14H,3-9H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of [(2S,6R)-2-hydroxyundecan-6-yl] formate?
[(2S,6R)-2-hydroxyundecan-6-yl] formate has a molecular weight of 216.32 g/mol, XLogP of 2.66, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,6R)-2-hydroxyundecan-6-yl] formate is sourced from PubChem (CID 23230297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).