C33H34O11S — CID 23244691
2-[(1R,2R,4S,5R)-4-[(3S,4S,5R)-5-(2-benzoyloxyethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]oxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethyl benzoate (PubChem CID 23244691) has the molecular formula C33H34O11S and a molecular weight of 638.69 g/mol. Its IUPAC name is 2-[(1R,2R,4S,5R)-4-[(3S,4S,5R)-5-(2-benzoyloxyethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]oxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethyl benzoate.
| Compound Name | 2-[(1R,2R,4S,5R)-4-[(3S,4S,5R)-5-(2-benzoyloxyethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]oxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethyl benzoate |
|---|---|
| PubChem CID | 23244691 |
| Molecular Formula | C33H34O11S |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 2-[(1R,2R,4S,5R)-4-[(3S,4S,5R)-5-(2-benzoyloxyethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl]oxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethyl benzoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@@H](O[C@@H]3O[C@H](CCOC(=O)c4ccccc4)[C@H]4O[C@@H]34)CO[C@@H]2CCOC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34O11S/c1-21-12-14-24(15-13-21)45(36,37)44-28-25(16-18-38-31(34)22-8-4-2-5-9-22)40-20-27(28)42-33-30-29(43-30)26(41-33)17-19-39-32(35)23-10-6-3-7-11-23/h2-15,25-30,33H,16-20H2,1H3/t25-,26-,27+,28+,29-,30-,33+/m1/s1 |
| InChIKey | RMTSRYQDPZPQBR-LWBSJKQRSA-N |
| XLogP | 3.84 |
| TPSA | 136.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|