C12H20O3 — CID 23254121
[(2S,3R,4aS,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate (PubChem CID 23254121) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(2S,3R,4aS,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate.
| Compound Name | [(2S,3R,4aS,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate |
|---|---|
| PubChem CID | 23254121 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(2S,3R,4aS,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate |
| SMILES | C[C@@H]1O[C@@H]2CCCC[C@H]2C[C@@]1(C)OC=O |
| InChI | InChI=1S/C12H20O3/c1-9-12(2,14-8-13)7-10-5-3-4-6-11(10)15-9/h8-11H,3-7H2,1-2H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | FPHKRYCZDZOVJO-NNYUYHANSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|