C15H29NO5Si — CID 23254549
[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(3R)-2-methyl-5-oxo-1,2-oxazolidin-3-yl]propyl] acetate (PubChem CID 23254549) has the molecular formula C15H29NO5Si and a molecular weight of 331.49 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(3R)-2-methyl-5-oxo-1,2-oxazolidin-3-yl]propyl] acetate.
| Compound Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(3R)-2-methyl-5-oxo-1,2-oxazolidin-3-yl]propyl] acetate |
|---|---|
| PubChem CID | 23254549 |
| Molecular Formula | C15H29NO5Si |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(3R)-2-methyl-5-oxo-1,2-oxazolidin-3-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@H](C[C@@H]1CC(=O)ON1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO5Si/c1-11(17)19-10-13(21-22(6,7)15(2,3)4)8-12-9-14(18)20-16(12)5/h12-13H,8-10H2,1-7H3/t12-,13+/m1/s1 |
| InChIKey | YTNUWGYCPWEIIT-OLZOCXBDSA-N |
| XLogP | 2.49 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|