About ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate
ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate (PubChem CID 23255522) has the molecular formula C17H16O5S
and a molecular weight of 332.38 g/mol. Its IUPAC name is ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate |
| PubChem CID | 23255522 |
| Molecular Formula | C17H16O5S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc(SC)cc1/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16O5S/c1-3-19-17(18)16-12(9-15(22-16)23-2)6-4-11-5-7-13-14(8-11)21-10-20-13/h4-9H,3,10H2,1-2H3/b6-4+ |
| InChIKey | PPYRVDHHTGPZDM-GQCTYLIASA-N |
| XLogP | 4.08 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate?
The IUPAC name of ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate (CID 23255522) is ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate.
What is the SMILES notation for ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate?
The canonical SMILES for ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate is CCOC(=O)c1oc(SC)cc1/C=C/c1ccc2c(c1)OCO2.
What is the InChIKey of ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate?
The InChIKey is PPYRVDHHTGPZDM-GQCTYLIASA-N. The full InChI is InChI=1S/C17H16O5S/c1-3-19-17(18)16-12(9-15(22-16)23-2)6-4-11-5-7-13-14(8-11)21-10-20-13/h4-9H,3,10H2,1-2H3/b6-4+.
What are the key properties of ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate?
ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate has a molecular weight of 332.38 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5-methylsulfanylfuran-2-carboxylate is sourced from PubChem (CID 23255522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).