C16H16N2O4 — CID 21235017
ethyl (Z)-3-[[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]amino]-2-cyanobut-2-enoate (PubChem CID 21235017) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is ethyl (Z)-3-[[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]amino]-2-cyanobut-2-enoate.
| Compound Name | ethyl (Z)-3-[[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]amino]-2-cyanobut-2-enoate |
|---|---|
| PubChem CID | 21235017 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl (Z)-3-[[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]amino]-2-cyanobut-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(/C)N/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16N2O4/c1-3-20-16(19)13(9-17)11(2)18-7-6-12-4-5-14-15(8-12)22-10-21-14/h4-8,18H,3,10H2,1-2H3/b7-6+,13-11- |
| InChIKey | BPYSOYAXOOOEOE-UJSHDLROSA-N |
| XLogP | 2.34 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|