C23H25N3O5S — CID 23255541
benzyl [(2R)-2-[(1R)-2-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-(methoxycarbonylamino)ethyl]sulfanylformate (PubChem CID 23255541) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is benzyl [(2R)-2-[(1R)-2-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-(methoxycarbonylamino)ethyl]sulfanylformate.
| Compound Name | benzyl [(2R)-2-[(1R)-2-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-(methoxycarbonylamino)ethyl]sulfanylformate |
|---|---|
| PubChem CID | 23255541 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | benzyl [(2R)-2-[(1R)-2-hydroxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-(methoxycarbonylamino)ethyl]sulfanylformate |
| SMILES | COC(=O)N[C@@H](CSC(=O)OCc1ccccc1)[C@@H]1c2[nH]c3ccccc3c2CCN1O |
| InChI | InChI=1S/C23H25N3O5S/c1-30-22(27)25-19(14-32-23(28)31-13-15-7-3-2-4-8-15)21-20-17(11-12-26(21)29)16-9-5-6-10-18(16)24-20/h2-10,19,21,24,29H,11-14H2,1H3,(H,25,27)/t19-,21+/m0/s1 |
| InChIKey | VANVCMKCDPTBCU-PZJWPPBQSA-N |
| XLogP | 4.25 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|