C10H18N4OS — CID 23274395
4-amino-6-hexyl-3-methylsulfanyl-1,2,4-triazin-5-one (PubChem CID 23274395) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-amino-6-hexyl-3-methylsulfanyl-1,2,4-triazin-5-one.
| Compound Name | 4-amino-6-hexyl-3-methylsulfanyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 23274395 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-amino-6-hexyl-3-methylsulfanyl-1,2,4-triazin-5-one |
| SMILES | CCCCCCc1nnc(SC)n(N)c1=O |
| InChI | InChI=1S/C10H18N4OS/c1-3-4-5-6-7-8-9(15)14(11)10(16-2)13-12-8/h3-7,11H2,1-2H3 |
| InChIKey | WBOVZFSEMBMSIG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|