C11H9NO2S — CID 23278428
5-deuterio-2-(4-methoxyphenyl)-1,3-thiazin-6-one (PubChem CID 23278428) has the molecular formula C11H9NO2S and a molecular weight of 220.27 g/mol. Its IUPAC name is 5-deuterio-2-(4-methoxyphenyl)-1,3-thiazin-6-one.
| Compound Name | 5-deuterio-2-(4-methoxyphenyl)-1,3-thiazin-6-one |
|---|---|
| PubChem CID | 23278428 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 5-deuterio-2-(4-methoxyphenyl)-1,3-thiazin-6-one |
| SMILES | [2H]c1cnc(-c2ccc(OC)cc2)sc1=O |
| InChI | InChI=1S/C11H9NO2S/c1-14-9-4-2-8(3-5-9)11-12-7-6-10(13)15-11/h2-7H,1H3/i6D |
| InChIKey | WZXOXEXJNLWKCB-RAMDWTOOSA-N |
| XLogP | 2.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |