C10H13N6O9P2-3 — CID 23278980
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(dioxido)-λ5-phosphanylidene]amino]phosphinate (PubChem CID 23278980) has the molecular formula C10H13N6O9P2-3 and a molecular weight of 423.20 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(dioxido)-λ5-phosphanylidene]amino]phosphinate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(dioxido)-λ5-phosphanylidene]amino]phosphinate |
|---|---|
| PubChem CID | 23278980 |
| Molecular Formula | C10H13N6O9P2-3 |
| Molecular Weight | 423.20 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(dioxido)-λ5-phosphanylidene]amino]phosphinate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])N=P([O-])([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N6O9P2/c11-8-5-9(13-2-12-8)16(3-14-5)10-7(18)6(17)4(25-10)1-24-27(22,23)15-26(19,20)21/h2-4,6-7,10,17-18H,1H2,(H4-2,11,12,13,19,20,21,22,23)/q-2/p-1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | XVIAQGFXPWUDES-KQYNXXCUSA-M |
| XLogP | -3.83 |
| TPSA | 247.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.20 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|