C7H19NSSn — CID 23279046
N,N-dimethyl-2-trimethylstannylsulfanylethanamine (PubChem CID 23279046) has the molecular formula C7H19NSSn and a molecular weight of 268.01 g/mol. Its IUPAC name is N,N-dimethyl-2-trimethylstannylsulfanylethanamine.
| Compound Name | N,N-dimethyl-2-trimethylstannylsulfanylethanamine |
|---|---|
| PubChem CID | 23279046 |
| Molecular Formula | C7H19NSSn |
| Molecular Weight | 268.01 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N,N-dimethyl-2-trimethylstannylsulfanylethanamine |
| SMILES | CN(C)CCS[Sn](C)(C)C |
| InChI | InChI=1S/C4H11NS.3CH3.Sn/c1-5(2)3-4-6;;;;/h6H,3-4H2,1-2H3;3*1H3;/q;;;;+1/p-1 |
| InChIKey | FOWZCWIHYXAJGH-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.01 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |