C12H24ClO3P — CID 23280586
2-(2-chloroheptoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 23280586) has the molecular formula C12H24ClO3P and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-(2-chloroheptoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-(2-chloroheptoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 23280586 |
| Molecular Formula | C12H24ClO3P |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(2-chloroheptoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | CCCCCC(Cl)COP1OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H24ClO3P/c1-4-5-6-7-11(13)8-14-17-15-9-12(2,3)10-16-17/h11H,4-10H2,1-3H3 |
| InChIKey | NIAUOYVLXWIJKM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|