C7H17O12P3 — CID 23390088
[(1,2-dihydroxy-4-methylcyclopentyl)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 23390088) has the molecular formula C7H17O12P3 and a molecular weight of 386.12 g/mol. Its IUPAC name is [(1,2-dihydroxy-4-methylcyclopentyl)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [(1,2-dihydroxy-4-methylcyclopentyl)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 23390088 |
| Molecular Formula | C7H17O12P3 |
| Molecular Weight | 386.12 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | [(1,2-dihydroxy-4-methylcyclopentyl)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1CC(O)C(O)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1 |
| InChI | InChI=1S/C7H17O12P3/c1-5-2-6(8)7(9,3-5)4-17-21(13,14)19-22(15,16)18-20(10,11)12/h5-6,8-9H,2-4H2,1H3,(H,13,14)(H,15,16)(H2,10,11,12) |
| InChIKey | PTJZRYZIVYKNRA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.12 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|