C8H16NO11P3 — CID 158089123
[[(1S,2S,4R)-1-cyano-2-hydroxy-4-methylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 158089123) has the molecular formula C8H16NO11P3 and a molecular weight of 395.13 g/mol. Its IUPAC name is [[(1S,2S,4R)-1-cyano-2-hydroxy-4-methylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1S,2S,4R)-1-cyano-2-hydroxy-4-methylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 158089123 |
| Molecular Formula | C8H16NO11P3 |
| Molecular Weight | 395.13 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | [[(1S,2S,4R)-1-cyano-2-hydroxy-4-methylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@H]1C[C@H](O)[C@@](C#N)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1 |
| InChI | InChI=1S/C8H16NO11P3/c1-6-2-7(10)8(3-6,4-9)5-18-22(14,15)20-23(16,17)19-21(11,12)13/h6-7,10H,2-3,5H2,1H3,(H,14,15)(H,16,17)(H2,11,12,13)/t6-,7-,8-/m0/s1 |
| InChIKey | VQEQROWVVUMILY-FXQIFTODSA-N |
| XLogP | 0.63 |
| TPSA | 203.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|