C20H20BrNO2 — CID 2341763
(3Z)-1-(3-bromophenoxy)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 2341763) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is (3Z)-1-(3-bromophenoxy)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3Z)-1-(3-bromophenoxy)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 2341763 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (3Z)-1-(3-bromophenoxy)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C\C(=O)COc2cccc(Br)c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20BrNO2/c1-20(2)17-9-4-5-10-18(17)22(3)19(20)12-15(23)13-24-16-8-6-7-14(21)11-16/h4-12H,13H2,1-3H3/b19-12- |
| InChIKey | KIQGDLODDXSHEW-UNOMPAQXSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|