C9H12N4O — CID 23422332
1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone (PubChem CID 23422332) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone.
| Compound Name | 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone |
|---|---|
| PubChem CID | 23422332 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone |
| SMILES | CC(=O)N1CCNc2ncnc(C)c21 |
| InChI | InChI=1S/C9H12N4O/c1-6-8-9(12-5-11-6)10-3-4-13(8)7(2)14/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | HKOPJIUPEXCRTO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |