About 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone
1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone (PubChem CID 23422332) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone |
| PubChem CID | 23422332 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone |
| SMILES | CC(=O)N1CCNc2ncnc(C)c21 |
| InChI | InChI=1S/C9H12N4O/c1-6-8-9(12-5-11-6)10-3-4-13(8)7(2)14/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | HKOPJIUPEXCRTO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone?
The IUPAC name of 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone (CID 23422332) is 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone.
What is the SMILES notation for 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone?
The canonical SMILES for 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone is CC(=O)N1CCNc2ncnc(C)c21.
What is the InChIKey of 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone?
The InChIKey is HKOPJIUPEXCRTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-6-8-9(12-5-11-6)10-3-4-13(8)7(2)14/h5H,3-4H2,1-2H3,(H,10,11,12).
What are the key properties of 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone?
1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone has a molecular weight of 192.22 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-7,8-dihydro-6H-pteridin-5-yl)ethanone is sourced from PubChem (CID 23422332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).