About diazocarbamothioylsulfanyl N-diazocarbamodithioate
diazocarbamothioylsulfanyl N-diazocarbamodithioate (PubChem CID 23424475) has the molecular formula C2N6S4
and a molecular weight of 236.33 g/mol. Its IUPAC name is diazocarbamothioylsulfanyl N-diazocarbamodithioate.
Molecular Properties
| Compound Name | diazocarbamothioylsulfanyl N-diazocarbamodithioate |
| PubChem CID | 23424475 |
| Molecular Formula | C2N6S4 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 235.91 |
| IUPAC Name | diazocarbamothioylsulfanyl N-diazocarbamodithioate |
| SMILES | [N-]=[N+]=NC(=S)SSC(=S)N=[N+]=[N-] |
| InChI | InChI=1S/C2N6S4/c3-7-5-1(9)11-12-2(10)6-8-4 |
| InChIKey | RWWGCCAQWKCBIW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diazocarbamothioylsulfanyl N-diazocarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazocarbamothioylsulfanyl N-diazocarbamodithioate?
The IUPAC name of diazocarbamothioylsulfanyl N-diazocarbamodithioate (CID 23424475) is diazocarbamothioylsulfanyl N-diazocarbamodithioate.
What is the SMILES notation for diazocarbamothioylsulfanyl N-diazocarbamodithioate?
The canonical SMILES for diazocarbamothioylsulfanyl N-diazocarbamodithioate is [N-]=[N+]=NC(=S)SSC(=S)N=[N+]=[N-].
What is the InChIKey of diazocarbamothioylsulfanyl N-diazocarbamodithioate?
The InChIKey is RWWGCCAQWKCBIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N6S4/c3-7-5-1(9)11-12-2(10)6-8-4.
What are the key properties of diazocarbamothioylsulfanyl N-diazocarbamodithioate?
diazocarbamothioylsulfanyl N-diazocarbamodithioate has a molecular weight of 236.33 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazocarbamothioylsulfanyl N-diazocarbamodithioate is sourced from PubChem (CID 23424475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).