C26H30N2O — CID 23447973
1-[(3-methoxyphenyl)-naphthalen-2-ylmethyl]-2-methyl-4-prop-2-enylpiperazine (PubChem CID 23447973) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)-naphthalen-2-ylmethyl]-2-methyl-4-prop-2-enylpiperazine.
| Compound Name | 1-[(3-methoxyphenyl)-naphthalen-2-ylmethyl]-2-methyl-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 23447973 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 1-[(3-methoxyphenyl)-naphthalen-2-ylmethyl]-2-methyl-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN(C(c2cccc(OC)c2)c2ccc3ccccc3c2)C(C)C1 |
| InChI | InChI=1S/C26H30N2O/c1-4-14-27-15-16-28(20(2)19-27)26(23-10-7-11-25(18-23)29-3)24-13-12-21-8-5-6-9-22(21)17-24/h4-13,17-18,20,26H,1,14-16,19H2,2-3H3 |
| InChIKey | CIJVAAPWZMBJDI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|