C11H9IN2OS — CID 23537236
(4S)-4-hydroxy-4-(6-iodo-1,3-benzothiazol-2-yl)butanenitrile (PubChem CID 23537236) has the molecular formula C11H9IN2OS and a molecular weight of 344.18 g/mol. Its IUPAC name is (4S)-4-hydroxy-4-(6-iodo-1,3-benzothiazol-2-yl)butanenitrile.
| Compound Name | (4S)-4-hydroxy-4-(6-iodo-1,3-benzothiazol-2-yl)butanenitrile |
|---|---|
| PubChem CID | 23537236 |
| Molecular Formula | C11H9IN2OS |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | (4S)-4-hydroxy-4-(6-iodo-1,3-benzothiazol-2-yl)butanenitrile |
| SMILES | N#CCC[C@H](O)c1nc2ccc(I)cc2s1 |
| InChI | InChI=1S/C11H9IN2OS/c12-7-3-4-8-10(6-7)16-11(14-8)9(15)2-1-5-13/h3-4,6,9,15H,1-2H2/t9-/m0/s1 |
| InChIKey | XYIVIZBQXDDSGL-VIFPVBQESA-N |
| XLogP | 3.24 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|