C34H45F5O5S — CID 23538053
methyl 4-[7-(methoxymethoxy)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate (PubChem CID 23538053) has the molecular formula C34H45F5O5S and a molecular weight of 660.79 g/mol. Its IUPAC name is methyl 4-[7-(methoxymethoxy)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate.
| Compound Name | methyl 4-[7-(methoxymethoxy)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate |
|---|---|
| PubChem CID | 23538053 |
| Molecular Formula | C34H45F5O5S |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | methyl 4-[7-(methoxymethoxy)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate |
| SMILES | COCOc1ccc2c(c1)OCC(C)(c1ccc(C(=O)OC)cc1)C2CCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H45F5O5S/c1-32(26-15-13-25(14-16-26)31(40)42-3)23-43-30-22-27(44-24-41-2)17-18-28(30)29(32)12-9-7-5-4-6-8-10-20-45-21-11-19-33(35,36)34(37,38)39/h13-18,22,29H,4-12,19-21,23-24H2,1-3H3 |
| InChIKey | RHIWYXNJMDLWCC-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|